A5478812
3-Methylflavone-8-carboxylic acid , 98% , 3468-01-7
Synonym(s):
3-Methylflavone-8-carboxylic acid
CAS NO.:3468-01-7
Empirical Formula: C17H12O4
Molecular Weight: 280.27
MDL number: MFCD00040998
EINECS: 222-425-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB77.60 | In Stock |
|
| 25G | RMB259.20 | In Stock |
|
| 100g | RMB878.40 | In Stock |
|
| 1kg | RMB2479.20 | In Stock |
|
| 500G | RMB3808.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-236°C |
| Boiling point: | 485.1±45.0 °C(Predicted) |
| Density | 1.335±0.06 g/cm3(Predicted) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.85±0.40(Predicted) |
| color | White |
| BRN | 1433509 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C17H12O4/c1-10-14(18)12-8-5-9-13(17(19)20)16(12)21-15(10)11-6-3-2-4-7-11/h2-9H,1H3,(H,19,20) |
| InChIKey | KMMBBZOSQNLLMN-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=C(C(O)=O)C=CC=C2C(=O)C=1C |
| CAS DataBase Reference | 3468-01-7(CAS DataBase Reference) |
Description and Uses
The main active metabolite of Flavoxate hydrochloride (FX) in human.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HS Code | 2932996560 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




