A5480112
3-Methoxyphenylacetonitrile , 98% , 19924-43-7
Synonym(s):
3-Methoxybenzyl cyanide
CAS NO.：19924-43-7
Empirical Formula: C9H9NO
Molecular Weight: 147.17
MDL number: MFCD00001801
EINECS: 243-428-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB281.60 | In Stock |
|
| 500g | RMB1261.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8C |
| Boiling point: | 164-165 °C/20 mmHg (lit.) |
| Density | 1.054 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 221 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Water Solubility | INSOLUBLE |
| BRN | 1865539 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C9H9NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5H2,1H3 |
| InChIKey | LXKNAUOWEJWGTE-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=CC(OC)=C1 |
| CAS DataBase Reference | 19924-43-7(CAS DataBase Reference) |
| NIST Chemistry Reference | (3-Methoxyphenyl)acetonitrile(19924-43-7) |
Description and Uses
3-Methoxyphenylacetonitrile was used in the synthesis of:
- new immunogen for homovanillic acid
- β,β′-cyclobisalkylated melatoninergic phenylalkylamides
- α-sec-butyl-3-methoxy phenylacetonitrile, antispasmodic agent
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H402-H412 |
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
