A5485512
6-α-Methylprednisolone Solution , analyticalstandard,100ng/ulinAcetonitrile , 83-43-2
Synonym(s):
11β,17α,21-Trihydroxy-6α-methyl-1,4-pregnadiene-3,20-dione;6α-Methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione;6α-Methylprednisolone;Medrol;Medrone
CAS NO.:83-43-2
Empirical Formula: C22H30O5
Molecular Weight: 374.47
MDL number: MFCD00010591
EINECS: 201-476-4
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-237°C (dec.) |
| alpha | D20 +83° (dioxane) |
| Boiling point: | 423.47°C (rough estimate) |
| Density | 1.0868 (rough estimate) |
| refractive index | 82 ° (C=1, Dioxane) |
| storage temp. | 0-6°C |
| solubility | chloroform/methanol (9:1): 50 mg/mL, clear, faintly yellow |
| form | Solid |
| pka | 12.46±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 0.12g/L(25 ºC) |
| Merck | 14,6111 |
| BRN | 2340300 |
| BCS Class | 2 or 4 |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChIKey | VHRSUDSXCMQTMA-PJHHCJLFSA-N |
| SMILES | [H][C@@]12C[C@H](C)C3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(O)C(=O)CO |
| CAS DataBase Reference | 83-43-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Pregnadiene-3,20-dione, 11beta,17alpha,21-trihydroxy-6alpha-methyl-(83-43-2) |
| EPA Substance Registry System | Pregna-1,4-diene-3,20-dione, 11,17,21-trihydroxy-6-methyl-, (6.alpha.,11.beta.)- (83-43-2) |
Description and Uses
A glucocorticoid which displays anti-inflamatory and antioxidant properties and attenuates apoptosis in oligodendrocytes after injury. 6α-Methyl Prednisolone is neuroprotective.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| target organs | Adrenal gland,Immune system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-36-26 |
| WGK Germany | 2 |
| RTECS | TU4146000 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 2937290000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 2 |
| Hazardous Substances Data | 83-43-2(Hazardous Substances Data) |






