A5485912
Methyl 2,3-dichloropropionate , 98% , 3674-09-7
Synonym(s):
2,3-Dichloropropionic acid methyl ester;Methyl 2,3-dichloropropionate
CAS NO.:3674-09-7
Empirical Formula: C4H6Cl2O2
Molecular Weight: 157
MDL number: MFCD00000944
EINECS: 222-940-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 10g | RMB41.60 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB188.80 | In Stock |
|
| 500G | RMB774.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 52-55 °C/2 mmHg (lit.) |
| Density | 1.325 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 145 °F |
| storage temp. | Store below +30°C. |
| solubility | Soluble in ether, acetone, ethanol. |
| form | liquid |
| color | Colorless to Almost colorless |
| BRN | 1701891 |
| InChI | InChI=1S/C4H6Cl2O2/c1-8-4(7)3(6)2-5/h3H,2H2,1H3 |
| InChIKey | OFHMODDLBXETIK-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(Cl)CCl |
| CAS DataBase Reference | 3674-09-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2,3-dichloro-, methyl ester(3674-09-7) |
| EPA Substance Registry System | Propanoic acid, 2,3-dichloro-, methyl ester (3674-09-7) |
Description and Uses
Methyl 2,3-dichloropropionate can be used to produce 2-chloro-acrylic acid methyl ester at Heating. It is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318-H227-H314-H341 |
| Precautionary statements | P201-P202-P210-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P308+P313-P403+P235-P405-P501-P210e-P260h-P303+P361+P353-P305+P351+P338-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 23-24/25-37/39-26-16 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |




