A5491912
Methyl-PEG<SUB>4</SUB>-NHS Ester , 98% , 622405-78-1
CAS NO.：622405-78-1
Empirical Formula: C14H23NO8
Molecular Weight: 333.33
MDL number: MFCD11041112
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB63.20 | In Stock |
|
| 100MG | RMB199.20 | In Stock |
|
| 250mg | RMB399.20 | In Stock |
|
| 1g | RMB1119.20 | In Stock |
|
| 5g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 431.7±55.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO, DCM, DMF |
| form | solid or viscous liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C14H23NO8/c1-19-6-7-21-10-11-22-9-8-20-5-4-14(18)23-15-12(16)2-3-13(15)17/h2-11H2,1H3 |
| InChIKey | MAYFFZZPEREGBQ-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOC |
Description and Uses
m-PEG4-NHS ester is a PEG linker containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2928.00.5000 |
