A5495212
3-Maleimidopropionic Acid , 97% , 7423-55-4
Synonym(s):
N-(2-Carboxyethyl)maleimide;3-Maleimidopropionic acid
CAS NO.:7423-55-4
Empirical Formula: C7H7NO4
Molecular Weight: 169.13
MDL number: MFCD00043030
EINECS: 616-069-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250MG | RMB23.20 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25g | RMB436.80 | In Stock |
|
| 100g | RMB1580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-106 °C (lit.) |
| Boiling point: | 382.5±25.0 °C(Predicted) |
| Density | 1.473±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.18±0.10(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | Soluble in methanol, dimethyl formamide, alcohol and dimethyl sulfoxide. Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 1528952 |
| InChI | InChI=1S/C7H7NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2H,3-4H2,(H,11,12) |
| InChIKey | IUTPJBLLJJNPAJ-UHFFFAOYSA-N |
| SMILES | N1(CCC(O)=O)C(=O)C=CC1=O |
| CAS DataBase Reference | 7423-55-4(CAS DataBase Reference) |
Description and Uses
3-Maleimidopropionic acid contains a maleimide group and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol.
3-Maleimidopropionic acid is a sulfhydryl reactive heterobifunctional crosslinking reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





