A5495512
11-Maleimidoundecanoic acid , 95% , 57079-01-3
Synonym(s):
11-Maleimide undecanoic acid;2,5-Dihydro-2,5-dioxo-1H-pyrrole-1-undecanoic acid;Maleimidoundecanoic acid;MM-281;MUDA
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB235.20 | In Stock |
|
| 10g | RMB379.20 | In Stock |
|
| 25G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-90°C |
| Boiling point: | 452.8±18.0 °C(Predicted) |
| Density | 1.139±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Soluble in methanol, and chloroform. |
| pka | 4.78±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| InChI | 1S/C15H23NO4/c17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/h10-11H,1-9,12H2,(H,19,20) |
| InChIKey | UVZTZBRGZXIBLZ-UHFFFAOYSA-N |
| SMILES | OC(=O)CCCCCCCCCCN1C(=O)C=CC1=O |
Description and Uses
The maleimide functional group can be used to conjugate a variety of biomolecules such as enzymes and DNA to the polymer chain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




