A5498212
Methyl 3,4-diaminobenzoate , 98% , 36692-49-6
CAS NO.：36692-49-6
Empirical Formula: C8H10N2O2
Molecular Weight: 166.18
MDL number: MFCD00017098
EINECS: 628-323-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB100.00 | In Stock |
|
| 25G | RMB466.40 | In Stock |
|
| 100G | RMB1796.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-110 °C |
| Boiling point: | 376.9±22.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.02±0.10(Predicted) |
| color | White to Gray to Red |
| BRN | 2091675 |
| InChI | InChI=1S/C8H10N2O2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,9-10H2,1H3 |
| InChIKey | IOPLHGOSNCJOOO-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(N)C(N)=C1 |
| CAS DataBase Reference | 36692-49-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29224999 |
