A5500512
Methyl 4-Acetylbenzoate , 98% , 3609-53-8
Synonym(s):
4-Acetobenzoic acid methyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB159.20 | In Stock |
|
| 5G | RMB359.20 | In Stock |
|
| 25G | RMB1335.20 | In Stock |
|
| 50g | RMB2399.20 | In Stock |
|
| 100G | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-96 °C (lit.) |
| Boiling point: | 270.41°C (rough estimate) |
| Density | 1.1601 (rough estimate) |
| refractive index | 1.5190 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Amorphous Powder |
| color | White to pale yellow |
| InChI | InChI=1S/C10H10O3/c1-7(11)8-3-5-9(6-4-8)10(12)13-2/h3-6H,1-2H3 |
| InChIKey | QNTSFZXGLAHYLC-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C(C)=O)C=C1 |
| CAS DataBase Reference | 3609-53-8(CAS DataBase Reference) |
Description and Uses
Methyl 4-acetylbenzoate may be used in the preparation of 4-methoxycarbonyl-α-oxo-benzeneacetic acid and methyl 4-(2-(2-methylimidazo[1,2-a]pyridin-3-yl)-2-oxoacetyl)benzoate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29183000 |
