A5508212
Methyl 4-aminobutyrate hydrochloride , 99% , 13031-60-2
CAS NO.:13031-60-2
Empirical Formula: C5H12ClNO2
Molecular Weight: 153.61
MDL number: MFCD00043270
EINECS: 629-526-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB52.80 | In Stock |
|
| 25G | RMB174.40 | In Stock |
|
| 100G | RMB627.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-125 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3558996 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H11NO2.ClH/c1-8-5(7)3-2-4-6;/h2-4,6H2,1H3;1H |
| InChIKey | WPGPRLVPWACBHW-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)CCCN.Cl |
Description and Uses
Methyl 4-aminobutyrate, HCl
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | ES7065000 |
| F | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





