A5509712
4-Methyl-3-(trifluoromethyl)aniline , 98% , 65934-74-9
Synonym(s):
3-(Trifluoromethyl)-4-methylaniline
CAS NO.：65934-74-9
Empirical Formula: C8H8F3N
Molecular Weight: 175.15
MDL number: MFCD01631582
EINECS: 626-514-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB132.00 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 100G | RMB2060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 204 °C(lit.) |
| Density | 1.220 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 3.81±0.10(Predicted) |
| color | Pale Orange to Light Brown |
| Specific Gravity | 1.240 |
| BRN | 6776230 |
| InChI | InChI=1S/C8H8F3N/c1-5-2-3-6(12)4-7(5)8(9,10)11/h2-4H,12H2,1H3 |
| InChIKey | JBCDCYFEJQHTTA-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 65934-74-9(CAS DataBase Reference) |
Description and Uses
4-Methyl-3-(trifluoromethyl)aniline may be used as a starting reagent in the synthesis of tert-butyl 4-methyl-3-(trifluoromethyl)phenylcarbamate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HS Code | 2921490090 |
