A5510029
2-Amino-4-methoxyphenol , 95% , 20734-76-3
Synonym(s):
2-Hydroxy-5-methoxyaniline
| Pack Size | Price | Stock | Quantity |
| 1g | RMB62.40 | In Stock |
|
| 5g | RMB222.40 | In Stock |
|
| 25g | RMB863.20 | In Stock |
|
| 100g | RMB3391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-140 °C |
| Boiling point: | 289.1±25.0 °C(Predicted) |
| Density | 1.219±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.24±0.18(Predicted) |
| form | powder |
| color | Black |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H9NO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,8H2,1H3 |
| InChIKey | TUADYTFWZPZZTP-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(OC)C=C1N |
Description and Uses
2-Amino-4-methoxyphenol is a volatile constituent in the aroma concentrate of Tieguanyin teas[1]. 2-Amino-4-methoxyphenol is used for the synthesis of pyridine analogues[2].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 22-52/53 |
| Safety Statements | 61 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
