A5521312
Methyl 2-Aminoisonicotinate , 98% , 6937-03-7
CAS NO.：6937-03-7
Empirical Formula: C7H8N2O2
Molecular Weight: 152.15
MDL number: MFCD04039316
EINECS: 627-546-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25g | RMB243.20 | In Stock |
|
| 100g | RMB761.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-148 °C |
| Boiling point: | 296.1±20.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform |
| pka | 4.89±0.11(Predicted) |
| form | Crystalline Powder |
| color | White to brown |
| Water Solubility | Insoluble in water. |
| BRN | 128642 |
| InChI | InChI=1S/C7H8N2O2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3,(H2,8,9) |
| InChIKey | SVWWNEYBEFASMP-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 6937-03-7(CAS DataBase Reference) |
Description and Uses
A nitrogen monoxide synthetase inhibitor.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-20/22 |
| Safety Statements | 26-36-26/36-39-36/37/39-22 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
