A5521412
6-Methylnicotinic Acid Methyl Ester , 98% , 5470-70-2
Synonym(s):
Methyl 6-methylnicotinate
CAS NO.:5470-70-2
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00006340
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB183.20 | In Stock |
|
| 500g | RMB563.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-37 °C (lit.) |
| Boiling point: | 160 °C/106 mmHg (lit.) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| Flash point: | 218 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 3.92±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| BRN | 122940 |
| InChI | InChI=1S/C8H9NO2/c1-6-3-4-7(5-9-6)8(10)11-2/h3-5H,1-2H3 |
| InChIKey | VYPPZXZHYDSBSJ-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1C(OC)=O |
| CAS DataBase Reference | 5470-70-2(CAS DataBase Reference) |
Description and Uses
Methyl 6-methylpyridine-3-carboxylate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






