A5523512
Methocarbamol , ≥98% , 532-03-6
Synonym(s):
Guaiacol glyceryl ether carbamate;Methocarbamol
CAS NO.：532-03-6
Empirical Formula: C11H15NO5
Molecular Weight: 241.24
MDL number: MFCD00057662
EINECS: 208-524-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97°C |
| Boiling point: | 384.01°C (rough estimate) |
| Density | 1.2611 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.08±0.20(Predicted) |
| color | White to Off-White |
| Merck | 14,5980 |
| Major Application | clinical testing |
| InChI | InChI=1S/C11H15NO5/c1-15-9-4-2-3-5-10(9)16-6-8(13)7-17-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14) |
| InChIKey | GNXFOGHNGIVQEH-UHFFFAOYSA-N |
| SMILES | C(OC(=O)N)C(O)COC1=CC=CC=C1OC |
| CAS DataBase Reference | 532-03-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Methocarbamol(532-03-6) |
| EPA Substance Registry System | Methocarbamol (532-03-6) |
Description and Uses
For use as an adjunct to rest, physical therapy, and other measures for the relief of discomforts associated with acute, painful musculoskeletal conditions.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H317-H334 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-42/43 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | TY8750000 |
| TSCA | TSCA listed |
| HS Code | 29222990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 532-03-6(Hazardous Substances Data) |
