A5528412
2-Methyl-1-[4-(methylthio)phenyl] -2-morpholino-1-propanone , >98.0% , 71868-10-5
Synonym(s):
α-Methyl-4-(methylmercapto)-α-morpholinopropiophenone;2-Methyl[4-(methylthio)phenyl]-2-morpholinopropan-1-one;2-Methyl-1-[4-(methylthio)phenyl]-2-(4-morpholinyl)-1-propanone;2-Methyl-2-(4-morpholinyl)-1-[4-(methylthio)phenyl]-1-propanone
CAS NO.:71868-10-5
Empirical Formula: C15H21NO2S
Molecular Weight: 279.4
MDL number: MFCD00083014
EINECS: 400-600-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB86.40 | In Stock |
|
| 250g | RMB175.20 | In Stock |
|
| 500G | RMB320.00 | In Stock |
|
| 2.5kg | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C(lit.) |
| Boiling point: | 210°C/76mmHg(lit.) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| Flash point: | 165℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 162 in mg/100g standard fat at 20 ℃ |
| form | powder to crystal |
| pka | 4.77±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 17.9mg/L at 20℃ |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/C15H21NO2S/c1-15(2,16-8-10-18-11-9-16)14(17)12-4-6-13(19-3)7-5-12/h4-7H,8-11H2,1-3H3 |
| InChIKey | LWRBVKNFOYUCNP-UHFFFAOYSA-N |
| SMILES | CSc1ccc(cc1)C(=O)C(C)(C)N2CCOCC2 |
| LogP | 3.09 at 25℃ |
| CAS DataBase Reference | 71868-10-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanone, 2-methyl-1-[4-(methylthio)phenyl]-2-(4-morpholinyl)- (71868-10-5) |
Description and Uses
Photoinitiator-907 is an efficient UV photoinitiator for initiating UV polymerization of unsaturated prepolymer systems.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H360FD-H411 |
| Precautionary statements | P202-P264-P270-P273-P301+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 22-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Repr. 1B |

![2-Methyl-1-[4-(methylthio)phenyl]
-2-morpholino-1-propanone](https://img.chemicalbook.com/CAS/GIF/71868-10-5.gif)





