A5530112
MQAE [1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium bromide] , ≥97.0%, used for fluorescence analysis , 162558-52-3
Synonym(s):
(6-Methoxyquinolinio)acetic acid ethyl ester bromide;MQAE
CAS NO.:162558-52-3
Empirical Formula: C14H16BrNO3
Molecular Weight: 326.19
MDL number: MFCD00467854
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB464.00 | In Stock |
|
| 500MG | RMB1599.20 | In Stock |
|
| 1g | RMB2184.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-179 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble |
| form | powder |
| color | White |
| Appearance | Pale Yellow Solid |
| λmax | 350 nm |
| Biological Applications | Chloride indicator; diagnosis of diseases caused by elemental imbalances; detecting cancer cells,spores,stress biomarkers |
| InChI | 1S/C14H16NO3.BrH/c1-3-18-14(16)10-15-8-4-5-11-9-12(17-2)6-7-13(11)15;/h4-9H,3,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DSLLHVISNOIYHR-UHFFFAOYSA-M |
| SMILES | [Br-].CCOC(=O)C[n+]1cccc2cc(OC)ccc12 |
Description and Uses
1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium (bromide) is a fluorescent indicator dye that can be used to measure intracellular and extracellular chloride concentrations (absorption/emission max: 350/460 nm). It detects the ion via diffusion-limited collisional quenching.
MQAE is a fluorescent indicator dye that can be used to measure intracellular and extracellular chloride concentrations (absorption/emission max: 350/460 nm). It detects the ion via diffusion-limited collisional quenching.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-8-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![MQAE [1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium bromide]](https://img.chemicalbook.com/CAS/GIF/162558-52-3.gif)




