A5530912
Merocyanin 540 , Dyecontent,90% , 62796-23-0
CAS NO.:62796-23-0
Empirical Formula: C26H32N3NaO6S2
Molecular Weight: 569.67
MDL number: MFCD00013438
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB711.20 | In Stock |
|
| 500MG | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble |
| form | Solid |
| color | Dark purple to black |
| λmax | 555 nm |
| BRN | 3585252 |
| InChIKey | OSQUFVVXNRMSHL-LTHRDKTGSA-M |
| SMILES | [Na+].CCCCN1C(=O)C(=C\C=C\C=C2/Oc3ccccc3N2CCCS([O-])(=O)=O)\C(=O)N(CCCC)C1=S |
| EPA Substance Registry System | 3(2H)-Benzoxazolepropanesulfonic acid, 2-[4-(1,3-dibutyltetrahydro-4,6-dioxo-2-thioxo-5(2H)-pyrimidinylidene)-2-butenylidene]-, sodium salt (62796-23-0) |
Description and Uses
Sensitive probe for membrane potential. Selective staining of immature hemopoietic cells in flow cytometry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DM4866500 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |







