A5533012
p-Methoxyphenoxyacetic acid , 98% , 1877-75-4
CAS NO.:1877-75-4
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00014360
EINECS: 217-513-2
| Pack Size | Price | Stock | Quantity |
| 10G | RMB195.20 | In Stock |
|
| 50G | RMB756.80 | In Stock |
|
| 250G | RMB3031.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C |
| Boiling point: | 275.56°C (rough estimate) |
| Density | 1.2481 (rough estimate) |
| refractive index | 1.4345 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pK1:3.213 (25°C) |
| Appearance | Off-white to light brown Solid |
| BRN | 1874579 |
| InChI | InChI=1S/C9H10O4/c1-12-7-2-4-8(5-3-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | BHFSBJHPPFJCOS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COC1=CC=C(OC)C=C1 |
| CAS DataBase Reference | 1877-75-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, (4-methoxyphenoxy)-(1877-75-4) |
| EPA Substance Registry System | Acetic acid, (4-methoxyphenoxy)- (1877-75-4) |
Description and Uses
2-(4-Methoxyphenoxy)acetic Acid is a useful research chemical, a metabolite of mefexamide in human urine samples.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 44-36/37/38 |
| Safety Statements | 37/39-26 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29189990 |






