A5534412
5-Chloro-2-methylbenzoxazole , ≥98.0%(GC) , 19219-99-9
CAS NO.:19219-99-9
Empirical Formula: C8H6ClNO
Molecular Weight: 167.59
MDL number: MFCD00022850
EINECS: 242-888-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB88.80 | In Stock |
|
| 100G | RMB246.40 | In Stock |
|
| 500G | RMB1020.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-57 °C(lit.) |
| Boiling point: | 218-220 °C(lit.) |
| Density | 1.2295 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| pka | -0.45±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| InChI | InChI=1S/C8H6ClNO/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 |
| InChIKey | XVQGFGKAPKEUFT-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Cl)C=C2N=C1C |
| CAS DataBase Reference | 19219-99-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoxazole, 5-chloro-2-methyl- (19219-99-9) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | C,Xi |
| Risk Statements | 20/21/22-34-36/37/38-37/38-36 |
| Safety Statements | 26-27-36/37/39-45-36/39 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM4790000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29349990 |




