A5534612
5-Nitroisophthalic Acid Monomethyl Ester , ≥98% , 1955-46-0
Synonym(s):
Monomethyl 5-nitrobenzene-1,3-dicarboxylate
CAS NO.:1955-46-0
Empirical Formula: C9H7NO6
Molecular Weight: 225.15
MDL number: MFCD00009793
EINECS: 217-793-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB325.60 | In Stock |
|
| 500G | RMB1499.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182 °C (lit.) |
| Boiling point: | 366.65°C (rough estimate) |
| Density | 1.5322 (rough estimate) |
| vapor pressure | 0-0Pa at 25℃ |
| refractive index | 1.5200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 9g/L in organic solvents at 20 ℃ |
| pka | 3.11±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Slightly yellow |
| Water Solubility | insoluble |
| BRN | 1469253 |
| InChI | 1S/C9H7NO6/c1-16-9(13)6-2-5(8(11)12)3-7(4-6)10(14)15/h2-4H,1H3,(H,11,12) |
| InChIKey | ZCRNIIJXDRYWDU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(cc(c1)[N+]([O-])=O)C(O)=O |
| LogP | 1.65 at 25℃ |
| CAS DataBase Reference | 1955-46-0(CAS DataBase Reference) |
| EPA Substance Registry System | Monomethyl 5-nitroisophthalate (1955-46-0) |
Description and Uses
mono-Methyl 5-nitroisophthalate has been used as starting reagent in the synthesis of 3-amide-5-[(dipropylamino)carbonyl]benzoic acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T+ |
| Risk Statements | 36/37/38-26/27/28 |
| Safety Statements | 22-24/25-45-36/37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 13 - Non Combustible Solids |






