A5536112
1-(3-Methoxyphenyl)piperazine , ≥98.0%(GC) , 16015-71-7
CAS NO.:16015-71-7
Empirical Formula: C11H16N2O
Molecular Weight: 192.26
MDL number: MFCD00040733
EINECS: 240-154-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB336.00 | In Stock |
|
| 25G | RMB1013.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-204°C |
| Boiling point: | 150 °C/0.5 mmHg (lit.) |
| Density | 1.114 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| solubility | DMF: 10 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml |
| form | clear liquid |
| pka | 8.98±0.10(Predicted) |
| color | Colorless to Light yellow |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C11H16N2O/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 |
| InChIKey | PZIBVWUXWNYTNL-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC(OC)=C2)CCNCC1 |
| CAS DataBase Reference | 16015-71-7(CAS DataBase Reference) |
Description and Uses
1-(3-Methoxyphenyl)piperazine (Item No. 19273) is an analytical reference standard categorized as a piperazine. This product is intended for research and forensic applications.
1-(3-Methoxyphenyl)piperazine is an inhibitor of the human α1β2γ2 GABAA receptor.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3267 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |






