A5536512
Methyldiphenylchlorosilane , 95% , 144-79-6
Synonym(s):
Chloro-diphenyl-methylsilane;Diphenylmethylchlorosilane;DPMSCl;Methyldiphenylchlorosilane
CAS NO.：144-79-6
Empirical Formula: C13H13ClSi
Molecular Weight: 232.78
MDL number: MFCD00000498
EINECS: 205-639-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB64.80 | In Stock |
|
| 25G | RMB215.20 | In Stock |
|
| 100G | RMB775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22°C |
| Boiling point: | 295 °C (lit.) |
| Density | 1.107 g/mL at 25 °C (lit.) |
| vapor pressure | 3 mm Hg ( 125 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | sol most organic solvents; reacts with protic solvents
such as alcohols, acids, amines, water. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.128 |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2937445 |
| InChI | 1S/C13H13ClSi/c1-15(14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | OJZNZOXALZKPEA-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 144-79-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Silane, chloromethyldiphenyl-(144-79-6) |
| EPA Substance Registry System | Silane, chloromethyldiphenyl- (144-79-6) |
Description and Uses
Methyldiphenylchlorosilane can be used as protecting group for alcohols; reacts with carboxylic acids and sulfoximes; C-silylates lithium ester enolates.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Excepted Quantities | Not Permitted as Excepted Quantity |
