A5536612
4-Methoxy-2-nitrophenol , ≥98.0%(GC) , 1568-70-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB122.40 | In Stock |
|
| 10G | RMB178.40 | In Stock |
|
| 25G | RMB267.20 | In Stock |
|
| 50G | RMB566.40 | In Stock |
|
| 100G | RMB868.00 | In Stock |
|
| 250G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C (lit.) |
| Boiling point: | 298.4°C (rough estimate) |
| Density | 1.3375 (estimate) |
| refractive index | 1.5830 (rough estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol almost transparency. |
| pka | 7.33±0.14(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | 1S/C7H7NO4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3 |
| InChIKey | YBUGOACXDPDUIR-UHFFFAOYSA-N |
| SMILES | COc1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 1568-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-methoxy-2-nitro-(1568-70-3) |
Description and Uses
4-Methoxy-2-nitrophenol can treat obesity, prevent weight gain, promote weight loss, promote slimming, or treat or prevent the development of diabetes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
