A5543712
Methyl 2-fluoro-5-nitrobenzoate , 98% , 2965-22-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB110.40 | In Stock |
|
| 25G | RMB364.80 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| 500g | RMB3823.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-51℃ |
| Boiling point: | 303℃ |
| Density | 1.388 |
| Flash point: | 137℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| color | White to Yellow to Green |
| InChI | 1S/C8H6FNO4/c1-14-8(11)6-4-5(10(12)13)2-3-7(6)9/h2-4H,1H3 |
| InChIKey | JZLONOOYIXEAHM-UHFFFAOYSA-N |
| SMILES | [O-][N+](C1=CC=C(C(C(OC)=O)=C1)F)=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




