A5545312
1-methyl-1H-imidazole-5-carbaldehyde , 97% , 39021-62-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5g | RMB977.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-57 °C |
| Boiling point: | 120-130°C 2mm |
| Density | 1.14±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 3.87±0.10(Predicted) |
| form | solid |
| color | Light yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C5H6N2O/c1-7-4-6-2-5(7)3-8/h2-4H,1H3 |
| InChIKey | BNYKZFOZWZMEJD-UHFFFAOYSA-N |
| SMILES | C1N(C)C(C=O)=CN=1 |
| CAS DataBase Reference | 39021-62-0(CAS DataBase Reference) |
Description and Uses
1-Methyl-1H-imidazole-5-carbaldehyde used as a photoresponsive polymer and metal-organic backbone material for the preparation of hybrid matrix membranes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
