A5545512
Methyl4-Acetamido-2-methoxybenzoate , ≥98% , 4093-29-2
Synonym(s):
Methyl 4-acetamido-2-methoxybenzoate
CAS NO.:4093-29-2
Empirical Formula: C11H13NO4
Molecular Weight: 223.23
MDL number: MFCD00065258
EINECS: 223-839-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB222.40 | In Stock |
|
| 100G | RMB600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128.0 to 132.0 °C |
| Boiling point: | 417.5±35.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 14.09±0.70(Predicted) |
| color | Off-White to Light Beige |
| InChI | InChI=1S/C11H13NO4/c1-7(13)12-8-4-5-9(11(14)16-3)10(6-8)15-2/h4-6H,1-3H3,(H,12,13) |
| InChIKey | OERVVBDWGVOBIS-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(NC(C)=O)C=C1OC |
| CAS DataBase Reference | 4093-29-2(CAS DataBase Reference) |
Description and Uses
Methyl 4-acetamido-2-methoxybenzoate (Metoclopramide EP Impurity D) is an impurity of bromopride (B686645), which is an antiemetic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| WGK Germany | 3 |
| HS Code | 2924296000 |
| REACH Registrations | Active |





