A5547012
Methylene blue , ≥70.0% , 61-73-4
Synonym(s):
Methylene blue;Methylthioninium chloride;Basic Blue 9;Methylene Blue hydrate;Methylene Blue solution
CAS NO.:61-73-4
Empirical Formula: C16H18ClN3S
Molecular Weight: 319.85
MDL number: MFCD00012111
EINECS: 200-515-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB39.20 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB233.60 | In Stock |
|
| 500G | RMB604.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C (dec.)(lit.) |
| Density | 1.0 g/mL at 20 °C |
| refractive index | n20/D1.347 |
| Flash point: | 45 °C |
| storage temp. | room temp |
| solubility | Soluble in water, ethanol, ethylene glycol, methyl cellosolve |
| form | Liquid |
| pka | 2.6, 11.2(at 25℃) |
| Colour Index | 52015 |
| color | Green |
| Specific Gravity | 0.98 |
| Odor | Odorless |
| Water Solubility | 40 g/L (20 ºC) |
| λmax | 661 nm |
| Merck | 14,6060 |
| BRN | 3641570 |
| Biological Applications | Detecting microorganisms; treating diabetic retinopathy,macular degeneration,malignant uveal melanomas,erysipelas,hidradenitis suppurativa,inflammation,skin diseases |
| Major Application | microbiology |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C16H18N3S.ClH/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;/h5-10H,1-4H3;1H/q+1;/p-1 |
| InChIKey | CXKWCBBOMKCUKX-UHFFFAOYSA-M |
| SMILES | [Cl-].CN(C)c1ccc2N=C3C=C\C(C=C3Sc2c1)=[N+](/C)C |
| NIST Chemistry Reference | Methylene blue(61-73-4) |
| EPA Substance Registry System | Methylene blue (61-73-4) |
Description and Uses
Methylene Blue, 1% w/v aqueous solution is used as a dye in different staining procedures viz. Wright's stain and Jenner's stain. It also serves as an indicator and medicine. Further, it is used to examine RNA and DNA under the microscope or in a gel. It is widely used as a redox indicator in analytical chemistry. It is also used in the sulfide analysis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 10-41-22-20/21/22-36/37/38 |
| Safety Statements | 26-39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | SP5740000 |
| TSCA | TSCA listed |
| HS Code | 32049010 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazardous Substances Data | 61-73-4(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 1180mg/kg |



