A5548012
Methyl 2-amino-5-chlorobenzoate , ≥98.0%(GC) , 5202-89-1
CAS NO.:5202-89-1
Empirical Formula: C8H8ClNO2
Molecular Weight: 185.61
MDL number: MFCD00007837
EINECS: 225-992-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB149.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C (lit.) |
| Boiling point: | 168-170 °C/22 mmHg (lit.) |
| Density | 1.2797 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| Flash point: | 168-170°C/1mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | soluble in Methanol |
| pka | 1.76±0.10(Predicted) |
| form | Crystals or Crystal Powder |
| color | Cream to beige-brown |
| BRN | 1072894 |
| InChI | InChI=1S/C8H8ClNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
| InChIKey | IGHVUURTQGBABT-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Cl)=CC=C1N |
| CAS DataBase Reference | 5202-89-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-amino-5-chloro-, methyl ester(5202-89-1) |
Description and Uses
Methyl 2-Amino-5-chlorobenzoate is a building block that has been used as a reactant for the preparation of bacterial RNA polymerase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







