A5548212
3-Methyl-2-nitroanisole , ≥98.0%(GC) , 5345-42-6
CAS NO.：5345-42-6
Empirical Formula: C8H9NO3
Molecular Weight: 167.16
MDL number: MFCD00007179
EINECS: 226-295-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB258.40 | In Stock |
|
| 25G | RMB498.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-50 °C (lit.) |
| Boiling point: | 170 °C / 35mmHg |
| Density | 1.2917 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 2329690 |
| InChI | 1S/C8H9NO3/c1-6-4-3-5-7(12-2)8(6)9(10)11/h3-5H,1-2H3 |
| InChIKey | MGBRGNWARSQECY-UHFFFAOYSA-N |
| SMILES | COc1cccc(C)c1[N+]([O-])=O |
| CAS DataBase Reference | 5345-42-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 24/25-36-26-25-24 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
