A5549912
6-Methoxy-2-naphthol , ≥97.0%(HPLC) , 5111-66-0
Synonym(s):
2-Hydroxy-6-methoxynaphthalene;6-Methoxynaphthalen-2-ol;Naproxen impurity H (PhEur)
CAS NO.:5111-66-0
Empirical Formula: C11H10O2
Molecular Weight: 174.2
MDL number: MFCD00088677
EINECS: 629-038-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB287.20 | In Stock |
|
| 5G | RMB1063.20 | In Stock |
|
| 25G | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-152 °C |
| Boiling point: | 336.7±15.0 °C(Predicted) |
| Density | 1.193±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.76±0.40(Predicted) |
| form | Solid |
| color | Off-White to Light Brown |
| BRN | 2043873 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C11H10O2/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7,12H,1H3 |
| InChIKey | WWPKRXOOVICNJY-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(OC)C=C2)=CC=C1O |
| CAS DataBase Reference | 5111-66-0(CAS DataBase Reference) |
Description and Uses
6-Methoxy-2-naphthol is a reactant in the development of sirtuin inhibitors from pyrazolone and isoxazol-5-one cambinol analogs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8-9-23 |
| HS Code | 2909500090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




