PRODUCT Properties
| Melting point: | 131-134℃ |
| Boiling point: | 325℃ |
| Density | 1.426±0.06 g/cm3(Predicted) |
| RTECS | UQ7435000 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 10.19±0.50(Predicted) |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C4H5N3O2/c1-3-4(7(8)9)2-5-6-3/h2H,1H3,(H,5,6) |
| InChIKey | WTZYTQJELOHMMJ-UHFFFAOYSA-N |
| SMILES | N1C=C([N+]([O-])=O)C(C)=N1 |
Description and Uses
3-Methyl-4-nitropyrazole is a reactant used in the preparation of aminopyrazole derivatives as potent, selective and brain penetrant Leucine-rich repeat kinase 2(LRRK2) small molecule inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HS Code | 29331990 |
