A5550512
Methyl 3-methyl-2-furoate , ≥98.0%(GC) , 6141-57-7
Synonym(s):
3-Methylfuran-2-carboxylic acid methyl ester
CAS NO.：6141-57-7
Empirical Formula: C7H8O3
Molecular Weight: 140.14
MDL number: MFCD00014110
EINECS: 228-131-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB207.20 | In Stock |
|
| 5G | RMB719.20 | In Stock |
|
| 10g | RMB1199.20 | In Stock |
|
| 25G | RMB2519.20 | In Stock |
|
| 100G | RMB7039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-36 °C |
| Boiling point: | 60 °C (1 mmHg) |
| Density | 1.1624 (rough estimate) |
| refractive index | 1.4850 (estimate) |
| Flash point: | 60°C/1mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Low Melting Mass |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 116835 |
| InChI | InChI=1S/C7H8O3/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
| InChIKey | AQQYRDKMXXSIMP-UHFFFAOYSA-N |
| SMILES | O1C=CC(C)=C1C(OC)=O |
| LogP | 1.510 |
| CAS DataBase Reference | 6141-57-7(CAS DataBase Reference) |
Description and Uses
Methyl 3-Methylfuroate is a volatile substance in the unfermented apple pomace.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H335-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
| Safety Statements | 24/25-22 |
| WGK Germany | 3 |
| HS Code | 29321900 |
