A5552512
4-MercaptophenylaceticAcid , 95% , 39161-84-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB183.20 | In Stock |
|
| 1G | RMB479.20 | In Stock |
|
| 5G | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-109 °C (lit.) |
| Boiling point: | 336.0±17.0 °C(Predicted) |
| Density | 1.299±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), DMSO (Slightly) |
| pka | 4.21±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| Water Solubility | Slightly soluble in water. Soluble in Dichloromethane, Ethanol and Methanol |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C8H8O2S/c9-8(10)5-6-1-3-7(11)4-2-6/h1-4,11H,5H2,(H,9,10) |
| InChIKey | ORXSLDYRYTVAPC-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(S)C=C1 |
Description and Uses
4-MERCAPTOPHENYLACETIC ACID is a redox buffer that increases the folding rate of disulfide-containing proteins realative to traditional buffers such as glutathione and glutathione-disulfide. A useful synthetic intermediate for the preparation of novel antiinflammatory agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 2930909899 |








