A5553212
Methyl 2-bromo-5-nitrobenzoate , >97.0%(GC) , 6942-36-5
CAS NO.:6942-36-5
Empirical Formula: C8H6BrNO4
Molecular Weight: 260.04
MDL number: MFCD00010867
EINECS: 623-531-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-81 °C (lit.) |
| Boiling point: | 326.7±22.0 °C(Predicted) |
| Density | 1.673±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DCM. Ethyl Acetate |
| form | Crystalline Powder |
| color | Yellow |
| BRN | 2617575 |
| InChI | 1S/C8H6BrNO4/c1-14-8(11)6-4-5(10(12)13)2-3-7(6)9/h2-4H,1H3 |
| InChIKey | VSEYYEKRZNRECT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(ccc1Br)[N+]([O-])=O |
| CAS DataBase Reference | 6942-36-5(CAS DataBase Reference) |
Description and Uses
Methyl 2-bromo-5-nitrobenzoate may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




