A5555312
4-(2-Methoxyethyl)phenol , ≥98.0%(GC) , 56718-71-9
CAS NO.:56718-71-9
Empirical Formula: C9H12O2
Molecular Weight: 152.19
MDL number: MFCD00017537
EINECS: 260-354-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB38.40 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 50g | RMB100.80 | In Stock |
|
| 100G | RMB150.40 | In Stock |
|
| 250g | RMB366.40 | In Stock |
|
| 500G | RMB660.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-45 °C(lit.) |
| Boiling point: | 125 °C / 3mmHg |
| Density | 1.060±0.06 g/cm3(Predicted) |
| vapor pressure | 0.41Pa at 20℃ |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 10.00±0.15(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 8.42g/L at 20℃ |
| InChI | InChI=1S/C9H12O2/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5,10H,6-7H2,1H3 |
| InChIKey | FAYGEALAEQKPDI-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCOC)C=C1 |
| LogP | 1.79 at 20℃ |
| CAS DataBase Reference | 56718-71-9(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4-(2-methoxyethyl)- (56718-71-9) |
Description and Uses
4-(2-Methoxyethyl)phenol (also known as p-(2-Methoxyethyl)phenol) is the starting material for the synthesis of metoprolol tartrate. Metoprolol tartrate is a selective β₁-blocker used in the treatment of various cardiovascular conditions, particularly hypertension.
4-(2-Methoxyethyl)phenol is an Impurity of Metoprolol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |



![Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate)](https://img.chemicalbook.com/CAS/20210111/GIF/27303-40-8.gif)

