A5556412
3,4-Methylenedioxyphenylacetic Acid , ≥98.0%(GC) , 2861-28-1
Synonym(s):
1,3-Benzodioxole-5-acetic acid;Homopiperonylic acid
CAS NO.:2861-28-1
Empirical Formula: C9H8O4
Molecular Weight: 180.16
MDL number: MFCD00014576
EINECS: 220-679-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB467.20 | In Stock |
|
| 500g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-129 °C(lit.) |
| Boiling point: | 272.96°C (rough estimate) |
| Density | 1.2933 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Micro-Crystalline Powder |
| pka | 4.31±0.10(Predicted) |
| color | Beite to pale yellow |
| Water Solubility | Soluble in water (partly), ethanol, and methanol. |
| BRN | 177739 |
| InChI | InChI=1S/C9H8O4/c10-9(11)4-6-1-2-7-8(3-6)13-5-12-7/h1-3H,4-5H2,(H,10,11) |
| InChIKey | ODVLMCWNGKLROU-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(CC(O)=O)C=C2OC1 |
| CAS DataBase Reference | 2861-28-1(CAS DataBase Reference) |
Description and Uses
3,4-(Methylenedioxy)phenylacetic acid is used as organic intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![5-(Chloromethyl)benzo[d][1,3]dioxole](https://img.chemicalbook.com/CAS/GIF/20850-43-5.gif)

