A5556612
4-Methyl-2-oxovaleric Acid Sodium Salt , ≥98% , 4502-00-5
Synonym(s):
α-Ketoisocaproic acid sodium salt;4-Methyl-2-oxopentanoic acid sodium salt;4-Methyl-2-oxovaleric acid sodium salt;Ketoleucine sodium salt;Sodium 4-methyl-2-oxovalerate
CAS NO.:4502-00-5
Empirical Formula: C6H9NaO3
Molecular Weight: 152.12
MDL number: MFCD00064193
EINECS: 224-816-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB303.20 | In Stock |
|
| 5G | RMB1039.20 | In Stock |
|
| 25G | RMB3519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 275 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Odor | at 100.00 %. butyric valeric buttery |
| Odor Type | buttery |
| biological source | synthetic |
| JECFA Number | 633.1 |
| BRN | 4239297 |
| Stability: | Hygroscopic |
| Major Application | flavors and fragrances |
| InChI | 1S/C6H10O3.Na/c1-4(2)3-5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChIKey | IXFAZKRLPPMQEO-UHFFFAOYSA-M |
| SMILES | [Na+].CC(C)CC(=O)C([O-])=O |
| LogP | 0.17 |
| CAS DataBase Reference | 4502-00-5(CAS DataBase Reference) |
Description and Uses
Sodium 4-methyl-2-oxovalerate has been used for quantifying branched-chain keto acids from cell extracts by HPLC-fluorescence method.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25-22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |



