A5557012
Methyl 3-hydroxy-4-methoxybenzoate , >98.0%(GC) , 6702-50-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB255.20 | In Stock |
|
| 100g | RMB737.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67 °C (lit.) |
| Boiling point: | 102 °C(Press: 0.1 Torr) |
| Density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 9.15±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C9H10O4/c1-12-8-4-3-6(5-7(8)10)9(11)13-2/h3-5,10H,1-2H3 |
| InChIKey | QXOXUEFXRSIYSW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(OC)C(O)=C1 |
| LogP | 1.750 (est) |
Description and Uses
Methyl 3-hydroxy-4-methoxybenzoate may be used as starting reagent in the novel synthesis of gefitinib. Synthesis involves the alkylation of starting material, followed by nitration, reduction, cyclization, chlorination and two successive amination reactions. It may be used as starting reagent in the synthesis of methyl 5-(benzo[d][1,3]dioxol-5-yl)-4-methoxy-2-nitrobenzoate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189990 |




