A5557312
4’-(4-methylphenyl)-2,2’:6’,2’’-terpyridine , 98% , 89972-77-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB172.00 | In Stock |
|
| 1G | RMB559.20 | In Stock |
|
| 5G | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-170°C |
| Boiling point: | 484.6±40.0 °C(Predicted) |
| Density | 1.149±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 4.62±0.22(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C22H17N3/c1-16-8-10-17(11-9-16)18-14-21(19-6-2-4-12-23-19)25-22(15-18)20-7-3-5-13-24-20/h2-15H,1H3 |
| InChIKey | IDJYBUVHZHLIIT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)-c2cc(nc(c2)-c3ccccn3)-c4ccccn4 |
Description and Uses
4′-(4-Methylphenyl)-2,2′:6′,2′′-terpyridine may be used as a ligand in the synthesis of:
- terpyridine Ru(II) complexes
- terpyridine based Cd(II) and Hg(II) complexes
- heterobimetallic Ru(II)-Os(II) complexes
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | YT8450000 |
| Storage Class | 11 - Combustible Solids |







![4'-[4-(BROMOMETHYL)PHENYL]-2,2':6',2''-TERPYRIDINE](https://img.chemicalbook.com/CAS/GIF/89972-78-1.gif)