A5559312
3-Methylbenzofuran-2-carboxylic Acid , 98% , 24673-56-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB98.40 | In Stock |
|
| 5G | RMB131.20 | In Stock |
|
| 25G | RMB531.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-197 °C (lit.) |
| Boiling point: | 328.7±22.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.87±0.30(Predicted) |
| form | Powder |
| color | Beige |
| BRN | 132104 |
| InChI | InChI=1S/C10H8O3/c1-6-7-4-2-3-5-8(7)13-9(6)10(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | YMZTUCZCQMQFMK-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C(C)=C1C(O)=O |
| CAS DataBase Reference | 24673-56-1(CAS DataBase Reference) |
Description and Uses
3-Methylbenzofuran-2-carboxylic acid may be used in the preparation of 3-methyl-N-phenylbenzofuran-2-carboxamide by reacting with aniline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
