A5563212
Methyl 4-Bromo-3-hydroxybenzoate , ≥98.0% , 106291-80-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB98.40 | In Stock |
|
| 5G | RMB324.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-125 |
| Boiling point: | 318.0±22.0 °C(Predicted) |
| Density | 1.627±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Dichloromethane, Methanol |
| form | Burgandy Color |
| pka | 7.61±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H7BrO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| InChIKey | VYOFPLOREOHCDP-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(Br)C(O)=C1 |
| CAS DataBase Reference | 106291-80-9 |
Description and Uses
Methyl 4-BroMo-3-hydroxybenzoate is a reactant used in the preparation of selective inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2918290090 |
