A5565012
4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride) , ≥98% , 149507-36-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB167.20 | In Stock |
|
| 1G | RMB293.60 | In Stock |
|
| 5g | RMB1023.20 | In Stock |
|
| 10g | RMB1705.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-202 |
| Boiling point: | 321.6±52.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | crystal to powder |
| pka | 7.93±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C8H8BF3O3/c1-15-7-3-2-5(9(13)14)4-6(7)8(10,11)12/h2-4,13-14H,1H3 |
| InChIKey | BUSMBMGODABSIN-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1C(F)(F)F)B(O)O |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
