A5565812
Methyl phenoxyacetate , ≥99% , 2065-23-8
CAS NO.:2065-23-8
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00010227
EINECS: 218-176-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB34.40 | In Stock |
|
| 25G | RMB58.32 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| 500G | RMB588.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245 °C |
| Boiling point: | 243 °C (lit.) |
| Density | 1.149 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.149 |
| InChI | InChI=1S/C9H10O3/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | BZCKRPHEZOHHBK-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)COC1=CC=CC=C1 |
| LogP | 1.410 |
| CAS DataBase Reference | 2065-23-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, phenoxy-, methyl ester(2065-23-8) |
| EPA Substance Registry System | Acetic acid, phenoxy-, methyl ester (2065-23-8) |
Description and Uses
Methyl phenoxyacetate (MPOA) was used as an acylating agent in the synthesis of loracarbef, a carbacephalosporin antibiotic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29189900 |
| Storage Class | 12 - Non Combustible Liquids |




