A5566412
Methyl 2-fluoroacrylate, 95% , ≥95%, containing stabilizers , 2343-89-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100g | RMB599.20 | In Stock |
|
| 500g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 41°C |
| Density | 1,114 g/cm3 |
| vapor pressure | 70.6hPa at 25℃ |
| refractive index | 1.39 |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C4H5FO2/c1-3(5)4(6)7-2/h1H2,2H3 |
| InChIKey | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(F)=C |
| LogP | 0.931 at 25℃ and pH6.3 |
| Surface tension | 71.5mN/m at 1g/L and 20.4℃ |
Description and Uses
Methyl 2-fluoroacrylate is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302-H315-H319-H335 |
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36-24/25 |
| RIDADR | 1993 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | Ⅱ |
| HS Code | 29161290 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
