A5566812
Methyl all-cis-5,8,11,14,17-eicosapentaenoate , ≥97%(capillaryGC) , 2734-47-6
Synonym(s):
cis-5,8,11,14,17-Eicosapentaenoic acid methyl ester
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB52.00 | In Stock |
|
| 100MG | RMB176.80 | In Stock |
|
| 500MG | RMB479.20 | In Stock |
|
| 1g | RMB719.20 | In Stock |
|
| 5g | RMB2905.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -91℃ |
| Boiling point: | 115-125℃ (0.005 Torr) |
| Density | 0.912±0.06 g/cm3(Predicted) |
| refractive index | 1.4898 (589.3 nm 20℃) |
| Flash point: | 104 °C |
| storage temp. | -20°C |
| solubility | chloroform: 50 mg/mL, clear, colorless |
| form | liquid |
| color | Colorless to light yellow |
| BRN | 1914828 |
| Major Application | food and beverages |
| InChI | 1S/C21H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-20H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | QWDCYFDDFPWISL-JEBPEJKESA-N |
| SMILES | CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)OC |
| CAS Number Unlabeled | 2734-47-6 |
Description and Uses
Methyl eicosapentaenoate is the methyl ester derivative of Eicosapentaenoic acid (E477800). Methyl eicosapentaenoate is a highly unsaturated compound that is extracted from algae, and has some practical application in protecting stored grains against rice weevils.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H410 |
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-50/53-65-67 |
| Safety Statements | 24/25-62-61-60-33-29-16-9-2 |
| RIDADR | UN 1206 3/PG 2 |
| WGK Germany | 3 |
| F | 8-10-23 |
| Storage Class | 10 - Combustible liquids |









