A5566912
Methyl 3-bromo-4-hydroxybenzoate , ≥98% , 29415-97-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB47.20 | In Stock |
|
| 10G | RMB87.20 | In Stock |
|
| 25g | RMB191.20 | In Stock |
|
| 50G | RMB351.20 | In Stock |
|
| 100g | RMB553.60 | In Stock |
|
| 500g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110℃ |
| Boiling point: | 283.1±20.0 °C(Predicted) |
| Density | 1.627±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 6.82±0.18(Predicted) |
| form | solid |
| color | White |
| InChI | InChI=1S/C8H7BrO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3 |
| InChIKey | RKUNSPWAQIUGEZ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(O)C(Br)=C1 |
Description and Uses
A reactant used in the preparation of selective inhibitors. In unsymmetrical Ullman reaction between methyl 5bromovanillate (II) and methyl 3-bromo-4-hydroxybenzoate (III) yielded all the three possible dicarbomethoxy-dibenzo-pdioxms which were separated by repeated chromatography over silica gel. A phosphorus- and bromine-containing bifunctional monomer has been prepared from bis(chloromethyl)methylphosphine oxide and the sodium salt of methyl 3-bromo-4-hydroxybenzoate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| RIDADR | UN2811 |
| HS Code | 2918290090 |