A5571612
4-Methoxycarbonyl-2-nitrobenzeneboronic acid , ≥97% , 85107-55-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB275.20 | In Stock |
|
| 50g | RMB2156.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-171°C |
| Boiling point: | 441.0±55.0 °C(Predicted) |
| Density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.00±0.53(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C8H8BNO6/c1-16-8(11)5-2-3-6(9(12)13)7(4-5)10(14)15/h2-4,12-13H,1H3 |
| InChIKey | SFEJGHJCGQNFQC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(B(O)O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 85107-55-7(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
