A5573712
trans-4-Methylcyclohexyl Isocyanate , >98.0%(GC) , 32175-00-1
CAS NO.：32175-00-1
Empirical Formula: C8H13NO
Molecular Weight: 139.19
MDL number: MFCD06411231
EINECS: 608-715-5
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB47.20 | In Stock |
|
| 5ML | RMB103.20 | In Stock |
|
| 25ML | RMB263.20 | In Stock |
|
| 100ML | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 182°C |
| Density | 1.04 |
| Flash point: | 60°C |
| storage temp. | -20°C, stored under nitrogen |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C8H13NO/c1-7-2-4-8(5-3-7)9-6-10/h7-8H,2-5H2,1H3/t7-,8- |
| InChIKey | SWSXEZOUBBVKCO-ZKCHVHJHSA-N |
| SMILES | [C@@H]1(N=C=O)CC[C@@H](C)CC1 |
| CAS DataBase Reference | 32175-00-1(CAS DataBase Reference) |
Description and Uses
Trans-4-Methycyclohexyl isocyanate is used in organic synthesis and experimental research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2929100090 |
