A5590712
Methyl Terephthalaldehydate , >98.0%(GC) , 1571-08-0
Synonym(s):
Methyl benzaldehyde-4-carboxylate;Methyl terephthalaldehydate
CAS NO.:1571-08-0
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00006950
EINECS: 216-385-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 500G | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-63 °C (lit.) |
| Boiling point: | 265 °C (lit.) |
| bulk density | 528kg/m3 |
| Density | 1,2 g/cm3 |
| refractive index | 1.5260 (estimate) |
| Flash point: | 144 °C |
| storage temp. | Store below +30°C. |
| solubility | methanol: 0.1 g/mL, clear |
| form | Crystalline Powder or Chunks |
| color | White to cream or slightly green |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 775895 |
| Stability: | Stable, though possibly air-sensitive. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C9H8O3/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-6H,1H3 |
| InChIKey | FEIOASZZURHTHB-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)C(=O)OC |
| LogP | 2.050 (est) |
| CAS DataBase Reference | 1571-08-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-HC(O)-C6H4-COOCH3(1571-08-0) |
| EPA Substance Registry System | Benzoic acid, 4-formyl-, methyl ester (1571-08-0) |
Description and Uses
4-Formylbenzoic Acid Methyl Ester is a benzoic acid derivative with antioxidant activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| Autoignition Temperature | 240°C |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 1571-08-0(Hazardous Substances Data) |







